C11H10O — CID 12895915
1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 12895915) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | 1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 12895915 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | CC12C=CC(O1)c1ccccc12 |
| InChI | InChI=1S/C11H10O/c1-11-7-6-10(12-11)8-4-2-3-5-9(8)11/h2-7,10H,1H3 |
| InChIKey | MQUQKIJUGILZCJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|