C20H17N3O — CID 1289597
4-(3,4-dimethylphenyl)-3-(furan-2-yl)-5-phenyl-1,2,4-triazole (PubChem CID 1289597) has the molecular formula C20H17N3O and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-3-(furan-2-yl)-5-phenyl-1,2,4-triazole.
| Compound Name | 4-(3,4-dimethylphenyl)-3-(furan-2-yl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 1289597 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-3-(furan-2-yl)-5-phenyl-1,2,4-triazole |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nnc2-c2ccco2)cc1C |
| InChI | InChI=1S/C20H17N3O/c1-14-10-11-17(13-15(14)2)23-19(16-7-4-3-5-8-16)21-22-20(23)18-9-6-12-24-18/h3-13H,1-2H3 |
| InChIKey | WBBFNDNFGGHFJD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |