C9H14B3NO2 — CID 12896202
2,4,6-trimethyl-5-phenyl-1,3,5,2,4,6-dioxazatriborinane (PubChem CID 12896202) has the molecular formula C9H14B3NO2 and a molecular weight of 200.65 g/mol. Its IUPAC name is 2,4,6-trimethyl-5-phenyl-1,3,5,2,4,6-dioxazatriborinane.
| Compound Name | 2,4,6-trimethyl-5-phenyl-1,3,5,2,4,6-dioxazatriborinane |
|---|---|
| PubChem CID | 12896202 |
| Molecular Formula | C9H14B3NO2 |
| Molecular Weight | 200.65 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2,4,6-trimethyl-5-phenyl-1,3,5,2,4,6-dioxazatriborinane |
| SMILES | CB1OB(C)N(c2ccccc2)B(C)O1 |
| InChI | InChI=1S/C9H14B3NO2/c1-10-13(9-7-5-4-6-8-9)11(2)15-12(3)14-10/h4-8H,1-3H3 |
| InChIKey | BNZRJEVBHFEXAE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|