C18H38N2O — CID 128963366
N-[2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 128963366) has the molecular formula C18H38N2O and a molecular weight of 298.51 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 128963366 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | N-[2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC1CC(C(C)C)OC(C(C)C)C1 |
| InChI | InChI=1S/C18H38N2O/c1-7-20(8-2)11-9-10-19-16-12-17(14(3)4)21-18(13-16)15(5)6/h14-19H,7-13H2,1-6H3 |
| InChIKey | BPDWPZDLLOSKQI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|