C16H16F3N3O2 — CID 128963974
1-[4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-2-(1H-pyrazol-5-yl)ethanone (PubChem CID 128963974) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 1-[4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-2-(1H-pyrazol-5-yl)ethanone.
| Compound Name | 1-[4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-2-(1H-pyrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 128963974 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-[4-hydroxy-2-[2-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-2-(1H-pyrazol-5-yl)ethanone |
| SMILES | O=C(Cc1ccn[nH]1)N1CC(O)CC1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O2/c17-16(18,19)13-4-2-1-3-12(13)14-8-11(23)9-22(14)15(24)7-10-5-6-20-21-10/h1-6,11,14,23H,7-9H2,(H,20,21) |
| InChIKey | PFZFLSJIRSOFAG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |