C32H32N4O4 — CID 128964458
(2Z,9Z)-6-[[3-hydroxy-1-(2-methylbut-3-en-2-yl)-2-oxoindol-3-yl]methyl]-11,11-dimethyl-5,8,13-triazatetracyclo[10.7.0.03,8.014,19]nonadeca-1(12),2,9,14,16,18-hexaene-4,7-dione (PubChem CID 128964458) has the molecular formula C32H32N4O4 and a molecular weight of 536.63 g/mol. Its IUPAC name is (2Z,9Z)-6-[[3-hydroxy-1-(2-methylbut-3-en-2-yl)-2-oxoindol-3-yl]methyl]-11,11-dimethyl-5,8,13-triazatetracyclo[10.7.0.03,8.014,19]nonadeca-1(12),2,9,14,16,18-hexaene-4,7-dione.
| Compound Name | (2Z,9Z)-6-[[3-hydroxy-1-(2-methylbut-3-en-2-yl)-2-oxoindol-3-yl]methyl]-11,11-dimethyl-5,8,13-triazatetracyclo[10.7.0.03,8.014,19]nonadeca-1(12),2,9,14,16,18-hexaene-4,7-dione |
|---|---|
| PubChem CID | 128964458 |
| Molecular Formula | C32H32N4O4 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (2Z,9Z)-6-[[3-hydroxy-1-(2-methylbut-3-en-2-yl)-2-oxoindol-3-yl]methyl]-11,11-dimethyl-5,8,13-triazatetracyclo[10.7.0.03,8.014,19]nonadeca-1(12),2,9,14,16,18-hexaene-4,7-dione |
| SMILES | C=CC(C)(C)N1C(=O)C(O)(CC2NC(=O)/C3=C/c4c([nH]c5ccccc45)C(C)(C)/C=C\N3C2=O)c2ccccc21 |
| InChI | InChI=1S/C32H32N4O4/c1-6-31(4,5)36-24-14-10-8-12-21(24)32(40,29(36)39)18-23-28(38)35-16-15-30(2,3)26-20(17-25(35)27(37)34-23)19-11-7-9-13-22(19)33-26/h6-17,23,33,40H,1,18H2,2-5H3,(H,34,37)/b16-15-,25-17- |
| InChIKey | BUTLVTAFDGYVNP-PFBNVUBMSA-N |
| XLogP | 4.23 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|