C15H17F3N4O2 — CID 128965016
N,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 128965016) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is N,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 128965016 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ocnc1C(=O)N(C)CC1CCc2nc(C(F)(F)F)cn2C1 |
| InChI | InChI=1S/C15H17F3N4O2/c1-9-13(19-8-24-9)14(23)21(2)5-10-3-4-12-20-11(15(16,17)18)7-22(12)6-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | SPTAGBAYEDRZKS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |