About 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one
1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one (PubChem CID 12896513) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one.
Molecular Properties
| Compound Name | 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one |
| PubChem CID | 12896513 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one |
| SMILES | O=C1C=CC2CCCN3CCC1C23 |
| InChI | InChI=1S/C11H15NO/c13-10-4-3-8-2-1-6-12-7-5-9(10)11(8)12/h3-4,8-9,11H,1-2,5-7H2 |
| InChIKey | UUCWLTTZRYFNQL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one?
The IUPAC name of 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one (CID 12896513) is 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one.
What is the SMILES notation for 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one?
The canonical SMILES for 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one is O=C1C=CC2CCCN3CCC1C23.
What is the InChIKey of 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one?
The InChIKey is UUCWLTTZRYFNQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c13-10-4-3-8-2-1-6-12-7-5-9(10)11(8)12/h3-4,8-9,11H,1-2,5-7H2.
What are the key properties of 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one?
1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one has a molecular weight of 177.25 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[6.3.1.04,12]dodec-6-en-5-one is sourced from PubChem (CID 12896513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).