About 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide
5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide (PubChem CID 128965553) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide |
| PubChem CID | 128965553 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide |
| SMILES | CC(CNC(=O)c1cn[nH]c1C1CCOC1)c1nccs1 |
| InChI | InChI=1S/C14H18N4O2S/c1-9(14-15-3-5-21-14)6-16-13(19)11-7-17-18-12(11)10-2-4-20-8-10/h3,5,7,9-10H,2,4,6,8H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | LSAPIKWNHFVUOG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide (CID 128965553) is 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide is CC(CNC(=O)c1cn[nH]c1C1CCOC1)c1nccs1.
What is the InChIKey of 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide?
The InChIKey is LSAPIKWNHFVUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c1-9(14-15-3-5-21-14)6-16-13(19)11-7-17-18-12(11)10-2-4-20-8-10/h3,5,7,9-10H,2,4,6,8H2,1H3,(H,16,19)(H,17,18).
What are the key properties of 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide?
5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide has a molecular weight of 306.39 g/mol, XLogP of 1.90, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolan-3-yl)-N-[2-(1,3-thiazol-2-yl)propyl]-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 128965553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).