C20H25NO3 — CID 128965877
3,3-dicyclopropyl-1-[4-hydroxy-2-(3-methoxyphenyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 128965877) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 3,3-dicyclopropyl-1-[4-hydroxy-2-(3-methoxyphenyl)pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 3,3-dicyclopropyl-1-[4-hydroxy-2-(3-methoxyphenyl)pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 128965877 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 3,3-dicyclopropyl-1-[4-hydroxy-2-(3-methoxyphenyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | COc1cccc(C2CC(O)CN2C(=O)C=C(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-24-17-4-2-3-15(9-17)19-10-16(22)12-21(19)20(23)11-18(13-5-6-13)14-7-8-14/h2-4,9,11,13-14,16,19,22H,5-8,10,12H2,1H3 |
| InChIKey | JEWPHVVBNSTJNL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|