C16H28N4O3 — CID 128966455
2-[[(2-amino-2-oxoethyl)-methylamino]methyl]-N-[2-(cyclopenten-1-yl)ethyl]morpholine-4-carboxamide (PubChem CID 128966455) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[[(2-amino-2-oxoethyl)-methylamino]methyl]-N-[2-(cyclopenten-1-yl)ethyl]morpholine-4-carboxamide.
| Compound Name | 2-[[(2-amino-2-oxoethyl)-methylamino]methyl]-N-[2-(cyclopenten-1-yl)ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 128966455 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-[[(2-amino-2-oxoethyl)-methylamino]methyl]-N-[2-(cyclopenten-1-yl)ethyl]morpholine-4-carboxamide |
| SMILES | CN(CC(N)=O)CC1CN(C(=O)NCCC2=CCCC2)CCO1 |
| InChI | InChI=1S/C16H28N4O3/c1-19(12-15(17)21)10-14-11-20(8-9-23-14)16(22)18-7-6-13-4-2-3-5-13/h4,14H,2-3,5-12H2,1H3,(H2,17,21)(H,18,22) |
| InChIKey | UAQCKXJOFBPCQI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|