About 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide
5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 128967329) has the molecular formula C13H16N4O2S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide |
| PubChem CID | 128967329 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | CC(NC(=O)c1cn[nH]c1C1CCOC1)c1nccs1 |
| InChI | InChI=1S/C13H16N4O2S/c1-8(13-14-3-5-20-13)16-12(18)10-6-15-17-11(10)9-2-4-19-7-9/h3,5-6,8-9H,2,4,7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | SBVSPZSEWFVTEU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide?
The IUPAC name of 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide (CID 128967329) is 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide.
What is the SMILES notation for 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide?
The canonical SMILES for 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide is CC(NC(=O)c1cn[nH]c1C1CCOC1)c1nccs1.
What is the InChIKey of 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide?
The InChIKey is SBVSPZSEWFVTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S/c1-8(13-14-3-5-20-13)16-12(18)10-6-15-17-11(10)9-2-4-19-7-9/h3,5-6,8-9H,2,4,7H2,1H3,(H,15,17)(H,16,18).
What are the key properties of 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide?
5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide has a molecular weight of 292.36 g/mol, XLogP of 1.86, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxolan-3-yl)-N-[1-(1,3-thiazol-2-yl)ethyl]-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 128967329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).