C14H18ClN5O3S — CID 128967939
2-amino-5-chloro-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]pyridine-3-sulfonamide (PubChem CID 128967939) has the molecular formula C14H18ClN5O3S and a molecular weight of 371.85 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-chloro-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 128967939 |
| Molecular Formula | C14H18ClN5O3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-amino-5-chloro-N-[2-(3-methylimidazol-4-yl)oxan-4-yl]pyridine-3-sulfonamide |
| SMILES | Cn1cncc1C1CC(NS(=O)(=O)c2cc(Cl)cnc2N)CCO1 |
| InChI | InChI=1S/C14H18ClN5O3S/c1-20-8-17-7-11(20)12-5-10(2-3-23-12)19-24(21,22)13-4-9(15)6-18-14(13)16/h4,6-8,10,12,19H,2-3,5H2,1H3,(H2,16,18) |
| InChIKey | CHBAXPACISEMET-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |