C23H30N4O3 — CID 128968559
2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 128968559) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 128968559 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(3aS,6aS)-3a-[3-(cyclopropylmethyl)-1,2,4-oxadiazol-5-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)CN1C[C@H]2CCC[C@@]2(c2nc(CC3CC3)no2)C1 |
| InChI | InChI=1S/C23H30N4O3/c1-29-19-7-3-2-5-17(19)12-24-21(28)14-27-13-18-6-4-10-23(18,15-27)22-25-20(26-30-22)11-16-8-9-16/h2-3,5,7,16,18H,4,6,8-15H2,1H3,(H,24,28)/t18-,23-/m1/s1 |
| InChIKey | LXCKUYXJWVOFSY-WZONZLPQSA-N |
| XLogP | 2.70 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |