C13H17ClN2O6S — CID 128968650
2-[(5-chlorofuran-2-carbonyl)-(1-methylsulfonylpiperidin-4-yl)amino]acetic acid (PubChem CID 128968650) has the molecular formula C13H17ClN2O6S and a molecular weight of 364.81 g/mol. Its IUPAC name is 2-[(5-chlorofuran-2-carbonyl)-(1-methylsulfonylpiperidin-4-yl)amino]acetic acid.
| Compound Name | 2-[(5-chlorofuran-2-carbonyl)-(1-methylsulfonylpiperidin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 128968650 |
| Molecular Formula | C13H17ClN2O6S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-[(5-chlorofuran-2-carbonyl)-(1-methylsulfonylpiperidin-4-yl)amino]acetic acid |
| SMILES | CS(=O)(=O)N1CCC(N(CC(=O)O)C(=O)c2ccc(Cl)o2)CC1 |
| InChI | InChI=1S/C13H17ClN2O6S/c1-23(20,21)15-6-4-9(5-7-15)16(8-12(17)18)13(19)10-2-3-11(14)22-10/h2-3,9H,4-8H2,1H3,(H,17,18) |
| InChIKey | WZTJNWCFLRFZFH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |