C21H29N3O — CID 128969041
N-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]-3-phenoxypropan-1-amine (PubChem CID 128969041) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is N-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]-3-phenoxypropan-1-amine.
| Compound Name | N-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]-3-phenoxypropan-1-amine |
|---|---|
| PubChem CID | 128969041 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]-3-phenoxypropan-1-amine |
| SMILES | CN(CCCOc1ccccc1)C[C@@H]1CCN(C)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C21H29N3O/c1-23(13-7-15-25-20-9-4-3-5-10-20)17-19-11-14-24(2)21(19)18-8-6-12-22-16-18/h3-6,8-10,12,16,19,21H,7,11,13-15,17H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | XYYSERUKXKLBLN-FPOVZHCZSA-N |
| XLogP | 3.48 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|