About 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide
2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide (PubChem CID 128969383) has the molecular formula C12H21N5O2S
and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide |
| PubChem CID | 128969383 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide |
| SMILES | CCc1nsc(N2CCOC(CN(C)CC(N)=O)C2)n1 |
| InChI | InChI=1S/C12H21N5O2S/c1-3-11-14-12(20-15-11)17-4-5-19-9(7-17)6-16(2)8-10(13)18/h9H,3-8H2,1-2H3,(H2,13,18) |
| InChIKey | CJHVTKOSHYXWGW-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide?
The IUPAC name of 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide (CID 128969383) is 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide.
What is the SMILES notation for 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide?
The canonical SMILES for 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide is CCc1nsc(N2CCOC(CN(C)CC(N)=O)C2)n1.
What is the InChIKey of 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide?
The InChIKey is CJHVTKOSHYXWGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O2S/c1-3-11-14-12(20-15-11)17-4-5-19-9(7-17)6-16(2)8-10(13)18/h9H,3-8H2,1-2H3,(H2,13,18).
What are the key properties of 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide?
2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide has a molecular weight of 299.40 g/mol, XLogP of -0.28, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-ethyl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]methyl-methylamino]acetamide is sourced from PubChem (CID 128969383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).