C17H20N4O4S — CID 128969543
[(3aS,6aS)-3a-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-nitrothiophen-2-yl)methanone (PubChem CID 128969543) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is [(3aS,6aS)-3a-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-nitrothiophen-2-yl)methanone.
| Compound Name | [(3aS,6aS)-3a-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-nitrothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 128969543 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(3aS,6aS)-3a-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(5-nitrothiophen-2-yl)methanone |
| SMILES | CC(C)c1noc([C@@]23CCC[C@@H]2CN(C(=O)c2ccc([N+](=O)[O-])s2)C3)n1 |
| InChI | InChI=1S/C17H20N4O4S/c1-10(2)14-18-16(25-19-14)17-7-3-4-11(17)8-20(9-17)15(22)12-5-6-13(26-12)21(23)24/h5-6,10-11H,3-4,7-9H2,1-2H3/t11-,17-/m1/s1 |
| InChIKey | VWOOOKMJUSCBEB-PIGZYNQJSA-N |
| XLogP | 3.36 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|