About 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide
2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide (PubChem CID 128970020) has the molecular formula C19H28N4O3
and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide.
Molecular Properties
| Compound Name | 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide |
| PubChem CID | 128970020 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide |
| SMILES | CCN(C(=O)Cn1cnc2c(c1=O)CCN(C(C)=O)C2)C1CCCCC1 |
| InChI | InChI=1S/C19H28N4O3/c1-3-23(15-7-5-4-6-8-15)18(25)12-22-13-20-17-11-21(14(2)24)10-9-16(17)19(22)26/h13,15H,3-12H2,1-2H3 |
| InChIKey | ITGQGVMHRDCARO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide?
The IUPAC name of 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide (CID 128970020) is 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide.
What is the SMILES notation for 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide?
The canonical SMILES for 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide is CCN(C(=O)Cn1cnc2c(c1=O)CCN(C(C)=O)C2)C1CCCCC1.
What is the InChIKey of 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide?
The InChIKey is ITGQGVMHRDCARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O3/c1-3-23(15-7-5-4-6-8-15)18(25)12-22-13-20-17-11-21(14(2)24)10-9-16(17)19(22)26/h13,15H,3-12H2,1-2H3.
What are the key properties of 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide?
2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide has a molecular weight of 360.46 g/mol, XLogP of 1.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-acetyl-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-3-yl)-N-cyclohexyl-N-ethylacetamide is sourced from PubChem (CID 128970020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).