C13H16F3N5O2 — CID 128970030
2-methyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 128970030) has the molecular formula C13H16F3N5O2 and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-methyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-methyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 128970030 |
| Molecular Formula | C13H16F3N5O2 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-methyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | Cc1nnc(CN2CCCCC2c2nnc(CC(F)(F)F)o2)o1 |
| InChI | InChI=1S/C13H16F3N5O2/c1-8-17-19-11(22-8)7-21-5-3-2-4-9(21)12-20-18-10(23-12)6-13(14,15)16/h9H,2-7H2,1H3 |
| InChIKey | LTQXKLBYUUGFIB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |