C14H24N4O4 — CID 128970435
N-(2-ethoxyethyl)-2-[(2R,4R)-4-methoxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]acetamide (PubChem CID 128970435) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-[(2R,4R)-4-methoxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-ethoxyethyl)-2-[(2R,4R)-4-methoxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 128970435 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-(2-ethoxyethyl)-2-[(2R,4R)-4-methoxy-2-(3-methyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]acetamide |
| SMILES | CCOCCNC(=O)CN1C[C@H](OC)C[C@@H]1c1nc(C)no1 |
| InChI | InChI=1S/C14H24N4O4/c1-4-21-6-5-15-13(19)9-18-8-11(20-3)7-12(18)14-16-10(2)17-22-14/h11-12H,4-9H2,1-3H3,(H,15,19)/t11-,12-/m1/s1 |
| InChIKey | DYJMBHWPMVAVEP-VXGBXAGGSA-N |
| XLogP | 0.29 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|