C14H21N3O3 — CID 128970459
N-[(2S,3S)-2-(1-methylimidazol-2-yl)oxolan-3-yl]oxane-2-carboxamide (PubChem CID 128970459) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[(2S,3S)-2-(1-methylimidazol-2-yl)oxolan-3-yl]oxane-2-carboxamide.
| Compound Name | N-[(2S,3S)-2-(1-methylimidazol-2-yl)oxolan-3-yl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 128970459 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[(2S,3S)-2-(1-methylimidazol-2-yl)oxolan-3-yl]oxane-2-carboxamide |
| SMILES | Cn1ccnc1[C@H]1OCC[C@@H]1NC(=O)C1CCCCO1 |
| InChI | InChI=1S/C14H21N3O3/c1-17-7-6-15-13(17)12-10(5-9-20-12)16-14(18)11-4-2-3-8-19-11/h6-7,10-12H,2-5,8-9H2,1H3,(H,16,18)/t10-,11?,12-/m0/s1 |
| InChIKey | LXIZNUPQUZXNNU-PRWSFJOGSA-N |
| XLogP | 0.94 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |