C16H19N3O3 — CID 128970509
N-[[2-(hydroxymethyl)phenyl]methyl]-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide (PubChem CID 128970509) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[[2-(hydroxymethyl)phenyl]methyl]-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[2-(hydroxymethyl)phenyl]methyl]-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 128970509 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[[2-(hydroxymethyl)phenyl]methyl]-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1CO)c1cn[nH]c1C1CCOC1 |
| InChI | InChI=1S/C16H19N3O3/c20-9-12-4-2-1-3-11(12)7-17-16(21)14-8-18-19-15(14)13-5-6-22-10-13/h1-4,8,13,20H,5-7,9-10H2,(H,17,21)(H,18,19) |
| InChIKey | ROXJMDFBIQXKTH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |