About 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine
6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine (PubChem CID 128971682) has the molecular formula C16H23N5O2
and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine |
| PubChem CID | 128971682 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine |
| SMILES | CCOc1cc(N[C@H]2CCCO[C@@H]2c2nccn2CC)ncn1 |
| InChI | InChI=1S/C16H23N5O2/c1-3-21-8-7-17-16(21)15-12(6-5-9-23-15)20-13-10-14(22-4-2)19-11-18-13/h7-8,10-12,15H,3-6,9H2,1-2H3,(H,18,19,20)/t12-,15-/m0/s1 |
| InChIKey | UONGNFUYYOWBHY-WFASDCNBSA-N |
| XLogP | 2.42 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
The IUPAC name of 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine (CID 128971682) is 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine.
What is the SMILES notation for 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
The canonical SMILES for 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine is CCOc1cc(N[C@H]2CCCO[C@@H]2c2nccn2CC)ncn1.
What is the InChIKey of 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
The InChIKey is UONGNFUYYOWBHY-WFASDCNBSA-N. The full InChI is InChI=1S/C16H23N5O2/c1-3-21-8-7-17-16(21)15-12(6-5-9-23-15)20-13-10-14(22-4-2)19-11-18-13/h7-8,10-12,15H,3-6,9H2,1-2H3,(H,18,19,20)/t12-,15-/m0/s1.
What are the key properties of 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine?
6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine has a molecular weight of 317.39 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrimidin-4-amine is sourced from PubChem (CID 128971682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).