About [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol
[1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol (PubChem CID 128971825) has the molecular formula C14H24N8O
and a molecular weight of 320.40 g/mol. Its IUPAC name is [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol |
| PubChem CID | 128971825 |
| Molecular Formula | C14H24N8O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol |
| SMILES | CCCn1nnnc1CN[C@H]1CCCC[C@H]1n1cc(CO)nn1 |
| InChI | InChI=1S/C14H24N8O/c1-2-7-21-14(17-18-20-21)8-15-12-5-3-4-6-13(12)22-9-11(10-23)16-19-22/h9,12-13,15,23H,2-8,10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | JTWKHSRHZUGMNK-QWHCGFSZSA-N |
| XLogP | 0.44 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol?
The IUPAC name of [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol (CID 128971825) is [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol is CCCn1nnnc1CN[C@H]1CCCC[C@H]1n1cc(CO)nn1.
What is the InChIKey of [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol?
The InChIKey is JTWKHSRHZUGMNK-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H24N8O/c1-2-7-21-14(17-18-20-21)8-15-12-5-3-4-6-13(12)22-9-11(10-23)16-19-22/h9,12-13,15,23H,2-8,10H2,1H3/t12-,13+/m0/s1.
What are the key properties of [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol?
[1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol has a molecular weight of 320.40 g/mol, XLogP of 0.44, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1R,2S)-2-[(1-propyltetrazol-5-yl)methylamino]cyclohexyl]triazol-4-yl]methanol is sourced from PubChem (CID 128971825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).