C20H25F2N3O3 — CID 128974293
(2S,3S)-N-[(3,4-difluorophenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]-N-methyloxolane-3-carboxamide (PubChem CID 128974293) has the molecular formula C20H25F2N3O3 and a molecular weight of 393.43 g/mol. Its IUPAC name is (2S,3S)-N-[(3,4-difluorophenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]-N-methyloxolane-3-carboxamide.
| Compound Name | (2S,3S)-N-[(3,4-difluorophenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]-N-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 128974293 |
| Molecular Formula | C20H25F2N3O3 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2S,3S)-N-[(3,4-difluorophenyl)methyl]-2-[2-(3-methoxypropyl)pyrazol-3-yl]-N-methyloxolane-3-carboxamide |
| SMILES | COCCCn1nccc1[C@H]1OCC[C@@H]1C(=O)N(C)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H25F2N3O3/c1-24(13-14-4-5-16(21)17(22)12-14)20(26)15-7-11-28-19(15)18-6-8-23-25(18)9-3-10-27-2/h4-6,8,12,15,19H,3,7,9-11,13H2,1-2H3/t15-,19-/m0/s1 |
| InChIKey | BGMSPZMWHQLQRS-KXBFYZLASA-N |
| XLogP | 2.93 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|