C21H24N2O4S — CID 128974392
ethyl 2-[[[(1'R,4S)-6,7-dimethylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 128974392) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is ethyl 2-[[[(1'R,4S)-6,7-dimethylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[[(1'R,4S)-6,7-dimethylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 128974392 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | ethyl 2-[[[(1'R,4S)-6,7-dimethylspiro[2,3-dihydrochromene-4,2'-cyclopropane]-1'-carbonyl]amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(CNC(=O)[C@@H]2C[C@]23CCOc2cc(C)c(C)cc23)n1 |
| InChI | InChI=1S/C21H24N2O4S/c1-4-26-20(25)16-11-28-18(23-16)10-22-19(24)15-9-21(15)5-6-27-17-8-13(3)12(2)7-14(17)21/h7-8,11,15H,4-6,9-10H2,1-3H3,(H,22,24)/t15-,21-/m0/s1 |
| InChIKey | JDXUEIKKLNAIKW-BTYIYWSLSA-N |
| XLogP | 3.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |