C15H23ClN4O2 — CID 128974424
(5-chloro-1-ethyl-3-methylpyrazol-4-yl)-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl)methanone (PubChem CID 128974424) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is (5-chloro-1-ethyl-3-methylpyrazol-4-yl)-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl)methanone.
| Compound Name | (5-chloro-1-ethyl-3-methylpyrazol-4-yl)-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl)methanone |
|---|---|
| PubChem CID | 128974424 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (5-chloro-1-ethyl-3-methylpyrazol-4-yl)-(4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl)methanone |
| SMILES | CCn1nc(C)c(C(=O)N2CCC3OCCN(C)C3C2)c1Cl |
| InChI | InChI=1S/C15H23ClN4O2/c1-4-20-14(16)13(10(2)17-20)15(21)19-6-5-12-11(9-19)18(3)7-8-22-12/h11-12H,4-9H2,1-3H3 |
| InChIKey | LBPNLDQKGLHVEO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |