C18H22N2O3 — CID 128974683
[2-[1-hydroxy-1-(4-methoxyphenyl)ethyl]pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 128974683) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is [2-[1-hydroxy-1-(4-methoxyphenyl)ethyl]pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [2-[1-hydroxy-1-(4-methoxyphenyl)ethyl]pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 128974683 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [2-[1-hydroxy-1-(4-methoxyphenyl)ethyl]pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | COc1ccc(C(C)(O)C2CCCN2C(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-18(22,13-7-9-14(23-2)10-8-13)16-6-4-12-20(16)17(21)15-5-3-11-19-15/h3,5,7-11,16,19,22H,4,6,12H2,1-2H3 |
| InChIKey | ANJHQYVEZQKIDI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |