C13H22FN5O3 — CID 128974797
1-(2-ethoxyethyl)-3-[[(2S,4S)-4-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-2-yl]methyl]urea (PubChem CID 128974797) has the molecular formula C13H22FN5O3 and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-[[(2S,4S)-4-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-2-yl]methyl]urea.
| Compound Name | 1-(2-ethoxyethyl)-3-[[(2S,4S)-4-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 128974797 |
| Molecular Formula | C13H22FN5O3 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-[[(2S,4S)-4-fluoro-1-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidin-2-yl]methyl]urea |
| SMILES | CCOCCNC(=O)NC[C@@H]1C[C@H](F)CN1c1nnc(C)o1 |
| InChI | InChI=1S/C13H22FN5O3/c1-3-21-5-4-15-12(20)16-7-11-6-10(14)8-19(11)13-18-17-9(2)22-13/h10-11H,3-8H2,1-2H3,(H2,15,16,20)/t10-,11-/m0/s1 |
| InChIKey | MOAJJQQHRLWCCT-QWRGUYRKSA-N |
| XLogP | 0.63 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|