About 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide
4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide (PubChem CID 128975404) has the molecular formula C16H18N4O3S
and a molecular weight of 346.41 g/mol. Its IUPAC name is 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide |
| PubChem CID | 128975404 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)N[C@H]1CCO[C@@H]1c1ccnn1C |
| InChI | InChI=1S/C16H18N4O3S/c1-11-9-12(10-17)3-4-15(11)24(21,22)19-13-6-8-23-16(13)14-5-7-18-20(14)2/h3-5,7,9,13,16,19H,6,8H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | VLQWBIKNEDVBPR-BBRMVZONSA-N |
| XLogP | 1.41 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide?
The IUPAC name of 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide (CID 128975404) is 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide.
What is the SMILES notation for 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide?
The canonical SMILES for 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide is Cc1cc(C#N)ccc1S(=O)(=O)N[C@H]1CCO[C@@H]1c1ccnn1C.
What is the InChIKey of 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide?
The InChIKey is VLQWBIKNEDVBPR-BBRMVZONSA-N. The full InChI is InChI=1S/C16H18N4O3S/c1-11-9-12(10-17)3-4-15(11)24(21,22)19-13-6-8-23-16(13)14-5-7-18-20(14)2/h3-5,7,9,13,16,19H,6,8H2,1-2H3/t13-,16-/m0/s1.
What are the key properties of 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide?
4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide has a molecular weight of 346.41 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]benzenesulfonamide is sourced from PubChem (CID 128975404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).