C18H18F2N2O2 — CID 128975885
4-[[2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]methyl]benzamide (PubChem CID 128975885) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 4-[[2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 128975885 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-[[2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2CC(O)CC2c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C18H18F2N2O2/c19-13-5-6-16(20)15(7-13)17-8-14(23)10-22(17)9-11-1-3-12(4-2-11)18(21)24/h1-7,14,17,23H,8-10H2,(H2,21,24) |
| InChIKey | FHMWARYDYOGOSZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |