C18H24FN3O — CID 128975908
5-(3-fluorophenyl)-1-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]pyrrolidin-3-ol (PubChem CID 128975908) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-1-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]pyrrolidin-3-ol.
| Compound Name | 5-(3-fluorophenyl)-1-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 128975908 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 5-(3-fluorophenyl)-1-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]pyrrolidin-3-ol |
| SMILES | Cc1nn(C(C)C)cc1CN1CC(O)CC1c1cccc(F)c1 |
| InChI | InChI=1S/C18H24FN3O/c1-12(2)22-10-15(13(3)20-22)9-21-11-17(23)8-18(21)14-5-4-6-16(19)7-14/h4-7,10,12,17-18,23H,8-9,11H2,1-3H3 |
| InChIKey | KRYCCPHLOJFVLQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |