About N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide
N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide (PubChem CID 128976188) has the molecular formula C18H30N4O2
and a molecular weight of 334.46 g/mol. Its IUPAC name is N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide |
| PubChem CID | 128976188 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide |
| SMILES | CCn1nccc1[C@@H]1OCC[C@H]1CNC1CCC(NC(C)=O)CC1 |
| InChI | InChI=1S/C18H30N4O2/c1-3-22-17(8-10-20-22)18-14(9-11-24-18)12-19-15-4-6-16(7-5-15)21-13(2)23/h8,10,14-16,18-19H,3-7,9,11-12H2,1-2H3,(H,21,23)/t14-,15?,16?,18+/m0/s1 |
| InChIKey | HFXMDHHSOUAJGC-MMIPBJDJSA-N |
| XLogP | 2.02 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide?
The IUPAC name of N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide (CID 128976188) is N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide.
What is the SMILES notation for N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide?
The canonical SMILES for N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide is CCn1nccc1[C@@H]1OCC[C@H]1CNC1CCC(NC(C)=O)CC1.
What is the InChIKey of N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide?
The InChIKey is HFXMDHHSOUAJGC-MMIPBJDJSA-N. The full InChI is InChI=1S/C18H30N4O2/c1-3-22-17(8-10-20-22)18-14(9-11-24-18)12-19-15-4-6-16(7-5-15)21-13(2)23/h8,10,14-16,18-19H,3-7,9,11-12H2,1-2H3,(H,21,23)/t14-,15?,16?,18+/m0/s1.
What are the key properties of N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide?
N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide has a molecular weight of 334.46 g/mol, XLogP of 2.02, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methylamino]cyclohexyl]acetamide is sourced from PubChem (CID 128976188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).