About 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine
5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine (PubChem CID 128978429) has the molecular formula C11H16FN3O2
and a molecular weight of 241.27 g/mol. Its IUPAC name is 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine |
| PubChem CID | 128978429 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine |
| SMILES | COC[C@@H]1C[C@H](OC)CN1c1ncc(F)cn1 |
| InChI | InChI=1S/C11H16FN3O2/c1-16-7-9-3-10(17-2)6-15(9)11-13-4-8(12)5-14-11/h4-5,9-10H,3,6-7H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | OMWNFOPGLDDWDQ-UWVGGRQHSA-N |
| XLogP | 0.86 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine?
The IUPAC name of 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine (CID 128978429) is 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine.
What is the SMILES notation for 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine?
The canonical SMILES for 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine is COC[C@@H]1C[C@H](OC)CN1c1ncc(F)cn1.
What is the InChIKey of 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine?
The InChIKey is OMWNFOPGLDDWDQ-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H16FN3O2/c1-16-7-9-3-10(17-2)6-15(9)11-13-4-8(12)5-14-11/h4-5,9-10H,3,6-7H2,1-2H3/t9-,10-/m0/s1.
What are the key properties of 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine?
5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine has a molecular weight of 241.27 g/mol, XLogP of 0.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]pyrimidine is sourced from PubChem (CID 128978429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).