C29H32O5 — CID 12897879
(3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-7-trityloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 12897879) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is (3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-7-trityloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-7-trityloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 12897879 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (3aR,4R,6S,7S,7aR)-4-methoxy-2,2,6-trimethyl-7-trityloxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CO[C@@H]1O[C@@H](C)[C@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C29H32O5/c1-20-24(25-26(27(30-4)31-20)33-28(2,3)32-25)34-29(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-20,24-27H,1-4H3/t20-,24-,25+,26+,27+/m0/s1 |
| InChIKey | RQOQXRUFKVCSTP-CMKGNXEASA-N |
| XLogP | 5.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|