C17H21N7O — CID 128979667
1-[4-[[(2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]methyl]-2-methylphenyl]-1,2,4-triazole (PubChem CID 128979667) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[4-[[(2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]methyl]-2-methylphenyl]-1,2,4-triazole.
| Compound Name | 1-[4-[[(2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]methyl]-2-methylphenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 128979667 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-[4-[[(2S,4R)-4-methoxy-2-(1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]methyl]-2-methylphenyl]-1,2,4-triazole |
| SMILES | CO[C@@H]1C[C@@H](c2ncn[nH]2)N(Cc2ccc(-n3cncn3)c(C)c2)C1 |
| InChI | InChI=1S/C17H21N7O/c1-12-5-13(3-4-15(12)24-11-18-9-21-24)7-23-8-14(25-2)6-16(23)17-19-10-20-22-17/h3-5,9-11,14,16H,6-8H2,1-2H3,(H,19,20,22)/t14-,16+/m1/s1 |
| InChIKey | DMAYEVWONUKYRN-ZBFHGGJFSA-N |
| XLogP | 1.66 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |