About 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole
1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole (PubChem CID 128980052) has the molecular formula C14H26N4O2
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole.
Molecular Properties
| Compound Name | 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole |
| PubChem CID | 128980052 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole |
| SMILES | COC[C@@H]1C[C@H](OC)CN1Cc1cn(C(C)(C)C)nn1 |
| InChI | InChI=1S/C14H26N4O2/c1-14(2,3)18-8-11(15-16-18)7-17-9-13(20-5)6-12(17)10-19-4/h8,12-13H,6-7,9-10H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | ZVVAIJICNZAADO-STQMWFEESA-N |
| XLogP | 1.27 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole?
The IUPAC name of 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole (CID 128980052) is 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole.
What is the SMILES notation for 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole?
The canonical SMILES for 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole is COC[C@@H]1C[C@H](OC)CN1Cc1cn(C(C)(C)C)nn1.
What is the InChIKey of 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole?
The InChIKey is ZVVAIJICNZAADO-STQMWFEESA-N. The full InChI is InChI=1S/C14H26N4O2/c1-14(2,3)18-8-11(15-16-18)7-17-9-13(20-5)6-12(17)10-19-4/h8,12-13H,6-7,9-10H2,1-5H3/t12-,13-/m0/s1.
What are the key properties of 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole?
1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole has a molecular weight of 282.39 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-[[(2S,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]methyl]triazole is sourced from PubChem (CID 128980052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).