C15H17F3N4O — CID 128980186
[3-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-1-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 128980186) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is [3-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-1-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [3-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-1-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 128980186 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [3-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]piperidin-1-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | Cn1cc(C(F)(F)F)nc1C1CCCN(C(=O)c2ccc[nH]2)C1 |
| InChI | InChI=1S/C15H17F3N4O/c1-21-9-12(15(16,17)18)20-13(21)10-4-3-7-22(8-10)14(23)11-5-2-6-19-11/h2,5-6,9-10,19H,3-4,7-8H2,1H3 |
| InChIKey | JSKCVLKYCDAZOZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |