C10H16O7 — CID 12898019
trimethyl (2S,3R)-2-hydroxybutane-1,2,3-tricarboxylate (PubChem CID 12898019) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is trimethyl (2S,3R)-2-hydroxybutane-1,2,3-tricarboxylate.
| Compound Name | trimethyl (2S,3R)-2-hydroxybutane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 12898019 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | trimethyl (2S,3R)-2-hydroxybutane-1,2,3-tricarboxylate |
| SMILES | COC(=O)C[C@@](O)(C(=O)OC)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C10H16O7/c1-6(8(12)16-3)10(14,9(13)17-4)5-7(11)15-2/h6,14H,5H2,1-4H3/t6-,10-/m0/s1 |
| InChIKey | PGBQGAKMUFDUSD-WKEGUHRASA-N |
| XLogP | -0.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|