C15H25N3O2 — CID 128980719
N-[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]oxan-3-amine (PubChem CID 128980719) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]oxan-3-amine.
| Compound Name | N-[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]oxan-3-amine |
|---|---|
| PubChem CID | 128980719 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N-[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]oxan-3-amine |
| SMILES | CC(C)n1nccc1[C@H]1OCC[C@@H]1NC1CCCOC1 |
| InChI | InChI=1S/C15H25N3O2/c1-11(2)18-14(5-7-16-18)15-13(6-9-20-15)17-12-4-3-8-19-10-12/h5,7,11-13,15,17H,3-4,6,8-10H2,1-2H3/t12?,13-,15-/m0/s1 |
| InChIKey | DEFFXNRBBPTXAW-MHEXWIEDSA-N |
| XLogP | 2.06 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |