About [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol
[5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol (PubChem CID 128981517) has the molecular formula C14H24N2O3
and a molecular weight of 268.36 g/mol. Its IUPAC name is [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol |
| PubChem CID | 128981517 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol |
| SMILES | CO[C@H]1C[C@@H](CN(C)Cc2ccc(CO)o2)N(C)C1 |
| InChI | InChI=1S/C14H24N2O3/c1-15(8-12-4-5-13(10-17)19-12)7-11-6-14(18-3)9-16(11)2/h4-5,11,14,17H,6-10H2,1-3H3/t11-,14-/m0/s1 |
| InChIKey | ANJJURYLDJTLSG-FZMZJTMJSA-N |
| XLogP | 0.92 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol?
The IUPAC name of [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol (CID 128981517) is [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol?
The canonical SMILES for [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol is CO[C@H]1C[C@@H](CN(C)Cc2ccc(CO)o2)N(C)C1.
What is the InChIKey of [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol?
The InChIKey is ANJJURYLDJTLSG-FZMZJTMJSA-N. The full InChI is InChI=1S/C14H24N2O3/c1-15(8-12-4-5-13(10-17)19-12)7-11-6-14(18-3)9-16(11)2/h4-5,11,14,17H,6-10H2,1-3H3/t11-,14-/m0/s1.
What are the key properties of [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol?
[5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol has a molecular weight of 268.36 g/mol, XLogP of 0.92, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylamino]methyl]furan-2-yl]methanol is sourced from PubChem (CID 128981517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).