C12H19F3N4O2 — CID 128982107
3-[(2S,4R)-4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]-4-methyl-1,2,4-triazole (PubChem CID 128982107) has the molecular formula C12H19F3N4O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 3-[(2S,4R)-4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-[(2S,4R)-4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 128982107 |
| Molecular Formula | C12H19F3N4O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-[(2S,4R)-4-methoxy-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrolidin-2-yl]-4-methyl-1,2,4-triazole |
| SMILES | CO[C@@H]1C[C@@H](c2nncn2C)N(CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N4O2/c1-18-8-16-17-11(18)10-5-9(20-2)6-19(10)3-4-21-7-12(13,14)15/h8-10H,3-7H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | QDQUSFSNYVJFHF-ZJUUUORDSA-N |
| XLogP | 1.16 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|