C18H27NO3 — CID 128982447
2-[4-[[3-(methoxymethyl)phenyl]methyl]morpholin-3-yl]cyclopentan-1-ol (PubChem CID 128982447) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-[4-[[3-(methoxymethyl)phenyl]methyl]morpholin-3-yl]cyclopentan-1-ol.
| Compound Name | 2-[4-[[3-(methoxymethyl)phenyl]methyl]morpholin-3-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 128982447 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-[4-[[3-(methoxymethyl)phenyl]methyl]morpholin-3-yl]cyclopentan-1-ol |
| SMILES | COCc1cccc(CN2CCOCC2C2CCCC2O)c1 |
| InChI | InChI=1S/C18H27NO3/c1-21-12-15-5-2-4-14(10-15)11-19-8-9-22-13-17(19)16-6-3-7-18(16)20/h2,4-5,10,16-18,20H,3,6-9,11-13H2,1H3 |
| InChIKey | KROVPTIGUMLYGW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |