About tricyclo[6.2.1.02,6]undec-2(6)-ene
tricyclo[6.2.1.02,6]undec-2(6)-ene (PubChem CID 12898252) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is tricyclo[6.2.1.02,6]undec-2(6)-ene.
Molecular Properties
| Compound Name | tricyclo[6.2.1.02,6]undec-2(6)-ene |
| PubChem CID | 12898252 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | tricyclo[6.2.1.02,6]undec-2(6)-ene |
| SMILES | C1CC2=C(C1)C1CCC(C2)C1 |
| InChI | InChI=1S/C11H16/c1-2-9-6-8-4-5-10(7-8)11(9)3-1/h8,10H,1-7H2 |
| InChIKey | PTQJRKPGSQPGHV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[6.2.1.02,6]undec-2(6)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.2.1.02,6]undec-2(6)-ene?
The IUPAC name of tricyclo[6.2.1.02,6]undec-2(6)-ene (CID 12898252) is tricyclo[6.2.1.02,6]undec-2(6)-ene.
What is the SMILES notation for tricyclo[6.2.1.02,6]undec-2(6)-ene?
The canonical SMILES for tricyclo[6.2.1.02,6]undec-2(6)-ene is C1CC2=C(C1)C1CCC(C2)C1.
What is the InChIKey of tricyclo[6.2.1.02,6]undec-2(6)-ene?
The InChIKey is PTQJRKPGSQPGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-2-9-6-8-4-5-10(7-8)11(9)3-1/h8,10H,1-7H2.
What are the key properties of tricyclo[6.2.1.02,6]undec-2(6)-ene?
tricyclo[6.2.1.02,6]undec-2(6)-ene has a molecular weight of 148.25 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.2.1.02,6]undec-2(6)-ene is sourced from PubChem (CID 12898252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).