C17H20N2O — CID 128982987
(3S,4S)-4-methyl-1-(naphthalen-1-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 128982987) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (3S,4S)-4-methyl-1-(naphthalen-1-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-methyl-1-(naphthalen-1-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 128982987 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3S,4S)-4-methyl-1-(naphthalen-1-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | C[C@@H]1CN(Cc2cccc3ccccc23)C[C@H]1C(N)=O |
| InChI | InChI=1S/C17H20N2O/c1-12-9-19(11-16(12)17(18)20)10-14-7-4-6-13-5-2-3-8-15(13)14/h2-8,12,16H,9-11H2,1H3,(H2,18,20)/t12-,16-/m1/s1 |
| InChIKey | XVBTUXNMRSIPGZ-MLGOLLRUSA-N |
| XLogP | 2.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |