About (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide
(2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide (PubChem CID 128983815) has the molecular formula C13H20F2N2O3
and a molecular weight of 290.31 g/mol. Its IUPAC name is (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide |
| PubChem CID | 128983815 |
| Molecular Formula | C13H20F2N2O3 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide |
| SMILES | CO[C@H]1C[C@@H](C(N)=O)N(C(=O)C2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C13H20F2N2O3/c1-20-9-6-10(11(16)18)17(7-9)12(19)8-2-4-13(14,15)5-3-8/h8-10H,2-7H2,1H3,(H2,16,18)/t9-,10-/m0/s1 |
| InChIKey | RWRUWIHDBCTWMH-UWVGGRQHSA-N |
| XLogP | 0.91 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide?
The IUPAC name of (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide (CID 128983815) is (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide.
What is the SMILES notation for (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide?
The canonical SMILES for (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide is CO[C@H]1C[C@@H](C(N)=O)N(C(=O)C2CCC(F)(F)CC2)C1.
What is the InChIKey of (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide?
The InChIKey is RWRUWIHDBCTWMH-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H20F2N2O3/c1-20-9-6-10(11(16)18)17(7-9)12(19)8-2-4-13(14,15)5-3-8/h8-10H,2-7H2,1H3,(H2,16,18)/t9-,10-/m0/s1.
What are the key properties of (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide?
(2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide has a molecular weight of 290.31 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-methoxypyrrolidine-2-carboxamide is sourced from PubChem (CID 128983815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).