C13H23N3 — CID 12898419
N,N-dipropyl-4,5,6,7-tetrahydro-1H-indazol-5-amine (PubChem CID 12898419) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N,N-dipropyl-4,5,6,7-tetrahydro-1H-indazol-5-amine.
| Compound Name | N,N-dipropyl-4,5,6,7-tetrahydro-1H-indazol-5-amine |
|---|---|
| PubChem CID | 12898419 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N,N-dipropyl-4,5,6,7-tetrahydro-1H-indazol-5-amine |
| SMILES | CCCN(CCC)C1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C13H23N3/c1-3-7-16(8-4-2)12-5-6-13-11(9-12)10-14-15-13/h10,12H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | GLKCCTUKWPNZKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |