About 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one
3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one (PubChem CID 128984820) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one |
| PubChem CID | 128984820 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one |
| SMILES | CO[C@@H]1C[C@@H](CO)N(C(=O)CCc2ccoc2)C1 |
| InChI | InChI=1S/C13H19NO4/c1-17-12-6-11(8-15)14(7-12)13(16)3-2-10-4-5-18-9-10/h4-5,9,11-12,15H,2-3,6-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | YEGWWFIXNMGDJS-NWDGAFQWSA-N |
| XLogP | 0.82 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one?
The IUPAC name of 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one (CID 128984820) is 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one.
What is the SMILES notation for 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one?
The canonical SMILES for 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one is CO[C@@H]1C[C@@H](CO)N(C(=O)CCc2ccoc2)C1.
What is the InChIKey of 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one?
The InChIKey is YEGWWFIXNMGDJS-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H19NO4/c1-17-12-6-11(8-15)14(7-12)13(16)3-2-10-4-5-18-9-10/h4-5,9,11-12,15H,2-3,6-8H2,1H3/t11-,12+/m0/s1.
What are the key properties of 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one?
3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one has a molecular weight of 253.30 g/mol, XLogP of 0.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-3-yl)-1-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]propan-1-one is sourced from PubChem (CID 128984820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).