C17H24FNO3 — CID 128985759
2-[4-[2-(2-fluorophenoxy)ethyl]morpholin-3-yl]cyclopentan-1-ol (PubChem CID 128985759) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-[4-[2-(2-fluorophenoxy)ethyl]morpholin-3-yl]cyclopentan-1-ol.
| Compound Name | 2-[4-[2-(2-fluorophenoxy)ethyl]morpholin-3-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 128985759 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[4-[2-(2-fluorophenoxy)ethyl]morpholin-3-yl]cyclopentan-1-ol |
| SMILES | OC1CCCC1C1COCCN1CCOc1ccccc1F |
| InChI | InChI=1S/C17H24FNO3/c18-14-5-1-2-7-17(14)22-11-9-19-8-10-21-12-15(19)13-4-3-6-16(13)20/h1-2,5,7,13,15-16,20H,3-4,6,8-12H2 |
| InChIKey | UMGXTUCRZCYOCQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |